10-Amino-2-methyl-3-methylsulfanyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,7,9-tetraen-11-one
| Internal ID | 1a18123d-903f-4493-837a-a707e131cfba |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Pyrroloquinolines > Pyrrolo[4,3,2-de]quinolines |
| IUPAC Name | 10-amino-2-methyl-3-methylsulfanyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,7,9-tetraen-11-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H13N3OS/c1-15-10-9-6(12(15)17-2)3-4-14-8(9)5-7(13)11(10)16/h5H,3-4,13H2,1-2H3 |
| InChI Key | BWQVVSNLZOCGOQ-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07793322 g/mol |
| Topological Polar Surface Area (TPSA) | 85.70 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.03% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.84% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.18% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.20% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.79% | 95.93% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 89.07% | 91.76% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 86.60% | 95.69% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 86.41% | 80.71% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.56% | 96.67% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 85.11% | 98.46% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.90% | 83.82% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.74% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.81% | 94.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.58% | 94.42% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.68% | 90.71% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.65% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10332216 |
| LOTUS | LTS0070195 |
| wikiData | Q104947555 |