10-(3,5-Dimethylhept-1-enyl)-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one
| Internal ID | 80a25f11-43fc-4173-b227-dbc9b025a65b |
| Taxonomy | Organoheterocyclic compounds > Oxolanes |
| IUPAC Name | 10-(3,5-dimethylhept-1-enyl)-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one |
| SMILES (Canonical) | CCC(C)CC(C)C=CC1C=CC(C(C12C(C(=C)OC2=O)O)O)O |
| SMILES (Isomeric) | CCC(C)CC(C)C=CC1C=CC(C(C12C(C(=C)OC2=O)O)O)O |
| InChI | InChI=1S/C19H28O5/c1-5-11(2)10-12(3)6-7-14-8-9-15(20)17(22)19(14)16(21)13(4)24-18(19)23/h6-9,11-12,14-17,20-22H,4-5,10H2,1-3H3 |
| InChI Key | FCZKZHGNJNETSF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19367399 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
![2D Structure of 10-(3,5-Dimethylhept-1-enyl)-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/10-35-dimethylhept-1-enyl-467-trihydroxy-3-methylidene-2-oxaspiro45dec-8-en-1-one.jpg "2D Structure of 10-(3,5-Dimethylhept-1-enyl)-4,6,7-trihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.61% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.94% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 95.93% | 89.34% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.33% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.28% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.91% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.66% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.29% | 90.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.41% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.69% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.82% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.67% | 100.00% |
| CHEMBL268 | P43235 | Cathepsin K | 82.28% | 96.85% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.89% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75070177 |
| LOTUS | LTS0078241 |
| wikiData | Q103818900 |