10-(2-Hydroxy-4-methylpent-3-enyl)-10-methyl-2,6-dimethylidenebicyclo[7.2.0]undecan-5-ol
| Internal ID | cac41b0a-b7bc-4843-861d-b494aece9406 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Xeniaphyllane and xenicane diterpenoids |
| IUPAC Name | 10-(2-hydroxy-4-methylpent-3-enyl)-10-methyl-2,6-dimethylidenebicyclo[7.2.0]undecan-5-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H32O2/c1-13(2)10-16(21)11-20(5)12-17-14(3)7-9-19(22)15(4)6-8-18(17)20/h10,16-19,21-22H,3-4,6-9,11-12H2,1-2,5H3 |
| InChI Key | BQMIRYIEZBTKMJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of 10-(2-Hydroxy-4-methylpent-3-enyl)-10-methyl-2,6-dimethylidenebicyclo[7.2.0]undecan-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/10-2-hydroxy-4-methylpent-3-enyl-10-methyl-26-dimethylidenebicyclo720undecan-5-ol.jpg "2D Structure of 10-(2-Hydroxy-4-methylpent-3-enyl)-10-methyl-2,6-dimethylidenebicyclo[7.2.0]undecan-5-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.53% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.54% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.48% | 97.25% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.98% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.31% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.44% | 90.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.30% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.31% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.86% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.71% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.39% | 85.14% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.99% | 95.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.50% | 100.00% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 83.91% | 97.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.66% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.21% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73657403 |
| LOTUS | LTS0085204 |
| wikiData | Q104944437 |