1-Piperidin-1-yldeca-2,4-diene-1,6-dione
| Internal ID | 5ddf43fe-3e97-4579-a0ed-9b70902244a4 |
| Taxonomy | Organoheterocyclic compounds > Piperidines > N-acylpiperidines |
| IUPAC Name | 1-piperidin-1-yldeca-2,4-diene-1,6-dione |
| SMILES (Canonical) | CCCCC(=O)C=CC=CC(=O)N1CCCCC1 |
| SMILES (Isomeric) | CCCCC(=O)C=CC=CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H23NO2/c1-2-3-9-14(17)10-5-6-11-15(18)16-12-7-4-8-13-16/h5-6,10-11H,2-4,7-9,12-13H2,1H3 |
| InChI Key | WSNYQSDXCCPJJP-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.172878976 g/mol |
| Topological Polar Surface Area (TPSA) | 37.40 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.49% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.56% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.92% | 96.09% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 91.32% | 91.81% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.57% | 83.57% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 84.97% | 93.90% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.83% | 95.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.83% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.73% | 92.86% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.35% | 99.17% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.20% | 96.61% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.08% | 90.71% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.19% | 96.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.88% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.12% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper nigrum |
| PubChem | 72790044 |
| LOTUS | LTS0071906 |
| wikiData | Q105311984 |