1-Phenylhexa-2,4-diyn-1-ol
Internal ID | 90b42e5a-311a-4b7b-8227-531de700fdfc |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
IUPAC Name | 1-phenylhexa-2,4-diyn-1-ol |
SMILES (Canonical) | CC#CC#CC(C1=CC=CC=C1)O |
SMILES (Isomeric) | CC#CC#CC(C1=CC=CC=C1)O |
InChI | InChI=1S/C12H10O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9,12-13H,1H3 |
InChI Key | LRUCYFPADQKETK-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C12H10O |
Molecular Weight | 170.21 g/mol |
Exact Mass | 170.073164938 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 2.30 |
1-phenylhexa-2,4-diyn-1-ol |
1574-95-4 |
Benzenemethanol, alpha-1,3-pentadiynyl- |
1-Phenyl-2,4-hexadiyne-1-ol |
LRUCYFPADQKETK-UHFFFAOYSA- |
DTXSID20935663 |
InChI=1/C12H10O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9,12-13H,1H3 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 94.50% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 94.24% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 93.35% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.31% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.96% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.11% | 95.56% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 86.49% | 93.81% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.83% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.81% | 91.11% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.80% | 94.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.77% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.10% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia capillaris |
Artemisia scoparia |
PubChem | 5320528 |
LOTUS | LTS0093289 |
wikiData | Q82911736 |