1-Palmitoyl-galactosylglycerol
Internal ID | 17e53f3b-2092-4fc7-bdb8-807cccbed0a4 |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols > Glycosylmonoacylglycerols |
IUPAC Name | [(2S)-2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] hexadecanoate |
SMILES (Canonical) | CCCCCCCCCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)CO)O)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCC(=O)OC[C@H](CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)O |
InChI | InChI=1S/C25H48O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-21(28)32-17-19(27)18-33-25-24(31)23(30)22(29)20(16-26)34-25/h19-20,22-27,29-31H,2-18H2,1H3/t19-,20-,22+,23+,24-,25-/m1/s1 |
InChI Key | DWKQIHQQZYILDB-DISYYVGZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H48O9 |
Molecular Weight | 492.60 g/mol |
Exact Mass | 492.32983310 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 4.50 |
CHEMBL465806 |
1-hexadecanoyl-sn-beta-D-galactopyranosylglycerol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.44% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.70% | 99.17% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 96.37% | 85.94% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.23% | 97.29% |
CHEMBL2581 | P07339 | Cathepsin D | 95.40% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 92.58% | 92.50% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.57% | 92.86% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.51% | 97.25% |
CHEMBL299 | P17252 | Protein kinase C alpha | 90.32% | 98.03% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.42% | 91.11% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.73% | 100.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 87.53% | 92.08% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 86.99% | 82.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.59% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.11% | 93.56% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.56% | 94.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.55% | 91.24% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.41% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.93% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.14% | 96.95% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.44% | 89.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cibotium barometz |
PubChem | 10413348 |
LOTUS | LTS0076770 |
wikiData | Q104990586 |