1-Oleoyl Lysophosphatidic Acid
Internal ID | cc552753-b1bf-4b3e-b4fa-a40e48354d2f |
Taxonomy | Lipids and lipid-like molecules > Glycerophospholipids > Glycerophosphates > Lysophosphatidic acids > 1-acylglycerol-3-phosphates |
IUPAC Name | [(2R)-2-hydroxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate |
SMILES (Canonical) | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)O)O |
SMILES (Isomeric) | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)O |
InChI | InChI=1S/C21H41O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26/h9-10,20,22H,2-8,11-19H2,1H3,(H2,24,25,26)/b10-9-/t20-/m1/s1 |
InChI Key | WRGQSWVCFNIUNZ-GDCKJWNLSA-N |
Popularity | 1,972 references in papers |
Molecular Formula | C21H41O7P |
Molecular Weight | 436.50 g/mol |
Exact Mass | 436.25899064 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 5.20 |
Atomic LogP (AlogP) | 5.04 |
H-Bond Acceptor | 5 |
H-Bond Donor | 3 |
Rotatable Bonds | 20 |
1-Oleoyl-sn-glycerol 3-phosphate |
65528-98-5 |
lysophosphatidic acid |
1-Oleoyl-sn-glycero-3-phosphate |
CHEBI:62837 |
1-(9Z-octadecenoyl)-sn-glycero-3-phosphate |
PA(18:1/0:0) |
LysoPA(18:1) |
1-oleylglycerol 3-phosphate |
1-oleoylglycerol 3-phosphate |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6721 | 67.21% |
Caco-2 | - | 0.7384 | 73.84% |
Blood Brain Barrier | + | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.7286 | 72.86% |
Subcellular localzation | Mitochondria | 0.7379 | 73.79% |
OATP2B1 inhibitior | - | 0.8536 | 85.36% |
OATP1B1 inhibitior | + | 0.8435 | 84.35% |
OATP1B3 inhibitior | + | 0.9408 | 94.08% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | - | 0.6427 | 64.27% |
P-glycoprotein inhibitior | - | 0.5963 | 59.63% |
P-glycoprotein substrate | - | 0.8447 | 84.47% |
CYP3A4 substrate | + | 0.5347 | 53.47% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8588 | 85.88% |
CYP3A4 inhibition | - | 0.9108 | 91.08% |
CYP2C9 inhibition | - | 0.8698 | 86.98% |
CYP2C19 inhibition | - | 0.8100 | 81.00% |
CYP2D6 inhibition | - | 0.8933 | 89.33% |
CYP1A2 inhibition | - | 0.8351 | 83.51% |
CYP2C8 inhibition | - | 0.8410 | 84.10% |
CYP inhibitory promiscuity | - | 0.9640 | 96.40% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.7100 | 71.00% |
Carcinogenicity (trinary) | Non-required | 0.6139 | 61.39% |
Eye corrosion | - | 0.5967 | 59.67% |
Eye irritation | - | 0.7138 | 71.38% |
Skin irritation | - | 0.6995 | 69.95% |
Skin corrosion | + | 0.5878 | 58.78% |
Ames mutagenesis | - | 0.8900 | 89.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3708 | 37.08% |
Micronuclear | - | 0.7600 | 76.00% |
Hepatotoxicity | - | 0.5341 | 53.41% |
skin sensitisation | - | 0.8349 | 83.49% |
Respiratory toxicity | - | 0.5778 | 57.78% |
Reproductive toxicity | - | 0.8889 | 88.89% |
Mitochondrial toxicity | + | 0.5500 | 55.00% |
Nephrotoxicity | - | 0.6972 | 69.72% |
Acute Oral Toxicity (c) | III | 0.5863 | 58.63% |
Estrogen receptor binding | + | 0.7762 | 77.62% |
Androgen receptor binding | - | 0.6848 | 68.48% |
Thyroid receptor binding | - | 0.5286 | 52.86% |
Glucocorticoid receptor binding | - | 0.6321 | 63.21% |
Aromatase binding | - | 0.7583 | 75.83% |
PPAR gamma | + | 0.6272 | 62.72% |
Honey bee toxicity | - | 0.8593 | 85.93% |
Biodegradation | + | 0.7000 | 70.00% |
Crustacea aquatic toxicity | + | 0.7078 | 70.78% |
Fish aquatic toxicity | + | 0.9747 | 97.47% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3691 | Q13822 | Autotaxin |
100 nM |
Ki |
via Super-PRED
|
CHEMBL5968 | Q99677 | Lysophosphatidic acid receptor 4 |
8.1 nM |
EC50 |
via Super-PRED
|
CHEMBL5700 | Q9H1C0 | Lysophosphatidic acid receptor 5 |
54.95 nM |
EC50 |
via Super-PRED
|
CHEMBL3819 | Q92633 | Lysophosphatidic acid receptor Edg-2 |
80 nM 450 nM 5.6 nM |
EC50 EC50 Kd |
via Super-PRED
via Super-PRED via Super-PRED |
CHEMBL3724 | Q9HBW0 | Lysophosphatidic acid receptor Edg-4 |
2 nM |
EC50 |
via Super-PRED
|
CHEMBL3250 | Q9UBY5 | Lysophosphatidic acid receptor Edg-7 |
290 nM 77 nM |
EC50 EC50 |
via Super-PRED
via Super-PRED |
CHEMBL4794 | Q8NER1 | Vanilloid receptor |
754 nM |
Kd |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 99.51% | 97.29% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.37% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.96% | 96.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.50% | 92.86% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 96.49% | 85.94% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.39% | 89.63% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.03% | 100.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.19% | 95.17% |
CHEMBL2581 | P07339 | Cathepsin D | 92.62% | 98.95% |
CHEMBL4333 | P21453 | Sphingosine 1-phosphate receptor Edg-1 | 90.26% | 96.99% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.67% | 92.08% |
CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 89.30% | 94.01% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.18% | 91.71% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.45% | 92.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.16% | 94.33% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 84.52% | 97.00% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.36% | 91.81% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.31% | 93.31% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.11% | 94.73% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.32% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.09% | 93.56% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.41% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.34% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.23% | 96.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.06% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amaranthus blitum subsp. oleraceus |
PubChem | 5311263 |
LOTUS | LTS0240355 |
wikiData | Q27132220 |