1-O-(3,4,5-Trimethoxybenzoyl)-b-D-glucopyranoside
Internal ID | c768c6aa-ba6e-43ce-8e3d-e10796b2e96e |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3,4,5-trimethoxybenzoate |
SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)C(=O)OC2C(C(C(C(O2)CO)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)C(=O)OC2C(C(C(C(O2)CO)O)O)O |
InChI | InChI=1S/C16H22O10/c1-22-8-4-7(5-9(23-2)14(8)24-3)15(21)26-16-13(20)12(19)11(18)10(6-17)25-16/h4-5,10-13,16-20H,6H2,1-3H3 |
InChI Key | QRWNMJBTANFMHA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H22O10 |
Molecular Weight | 374.34 g/mol |
Exact Mass | 374.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 144.00 Ų |
XlogP | -0.40 |
56982-70-8 |
MEGxp0_000352 |
ACon1_000341 |
CHEBI:182224 |
AKOS040734724 |
NCGC00169169-01 |
BRD-A59603859-001-01-8 |
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3,4,5-trimethoxybenzoate |
NCGC00169169-02![3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3,4,5-trimethoxybenzoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.49% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.34% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.05% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.03% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.29% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.06% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.01% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.10% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 81.77% | 98.75% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.96% | 96.95% |
CHEMBL2581 | P07339 | Cathepsin D | 80.83% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.43% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prunus grayana |
Sargentodoxa cuneata |
PubChem | 23928103 |
LOTUS | LTS0246166 |
wikiData | Q105226704 |