1-Methyl-4-(6,10,14,18,22-pentamethyltricosa-1,5-dien-2-yl)cyclohexene
| Internal ID | 72b2a66f-fe68-4dd1-966e-f5b0e37e60cf |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids |
| IUPAC Name | 1-methyl-4-(6,10,14,18,22-pentamethyltricosa-1,5-dien-2-yl)cyclohexene |
| SMILES (Canonical) | CC1=CCC(CC1)C(=C)CCC=C(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| SMILES (Isomeric) | CC1=CCC(CC1)C(=C)CCC=C(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C35H64/c1-28(2)14-9-15-29(3)16-10-17-30(4)18-11-19-31(5)20-12-21-32(6)22-13-23-34(8)35-26-24-33(7)25-27-35/h22,24,28-31,35H,8-21,23,25-27H2,1-7H3 |
| InChI Key | HYJZKCOWAKHVCB-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C35H64 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.500802041 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 14.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.46% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.75% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.82% | 93.56% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 89.64% | 92.51% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.42% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.29% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.70% | 94.73% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.15% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.90% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.90% | 97.21% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.13% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.89% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.84% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.40% | 99.17% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.97% | 93.18% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.49% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.39% | 97.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.13% | 98.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.04% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74392093 |
| LOTUS | LTS0133863 |
| wikiData | Q105035344 |