1-Methyl-4-(6-methylhept-5-en-2-yl)cyclohexa-1,3-diene
| Internal ID | f2f4a121-a2fb-45fd-be96-b66f7b563933 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 1-methyl-4-(6-methylhept-5-en-2-yl)cyclohexa-1,3-diene |
| SMILES (Canonical) | CC1=CC=C(CC1)C(C)CCC=C(C)C |
| SMILES (Isomeric) | CC1=CC=C(CC1)C(C)CCC=C(C)C |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,10,14H,5,7,9,11H2,1-4H3 |
| InChI Key | NGIVKZGKEPRIGG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.70 |
| 1-methyl-4-(6-methylhept-5-en-2-yl)cyclohexa-1,3-diene |
| 451-55-8 |
| .gamma.-Curcumene |
| Curcumene, .gamma.- |
| DTXSID20423873 |
| NGIVKZGKEPRIGG-UHFFFAOYSA-N |
| 1,3-Cyclohexadiene, 1-(1,5-dimethyl-4-hexenyl)-4-methyl- |
| 1,3-Cyclohexadiene, 1-(1,5-dimethyl-4-hexen-1-yl)-4-methyl- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.75% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.12% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.84% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.76% | 97.21% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.27% | 91.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.24% | 93.56% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.69% | 87.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.99% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.17% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.21% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia schmidtiana |
| Bidens andicola |
| Calomeria infausta |
| Cupressus nootkatensis |
| Helichrysum mimetes |
| Libocedrus bidwillii |
| Olearia teretifolia |
| Plazia daphnoides |
| Trixis divaricata subsp. divaricata |
| PubChem | 6428861 |
| LOTUS | LTS0236580 |
| wikiData | Q82236195 |