1-Methoxyindole-3-carboxylic acid
| Internal ID | e824f72f-2141-4c45-bc7d-8cee03d914d3 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives |
| IUPAC Name | 1-methoxyindole-3-carboxylic acid |
| SMILES (Canonical) | CON1C=C(C2=CC=CC=C21)C(=O)O |
| SMILES (Isomeric) | CON1C=C(C2=CC=CC=C21)C(=O)O |
| InChI | InChI=1S/C10H9NO3/c1-14-11-6-8(10(12)13)7-4-2-3-5-9(7)11/h2-6H,1H3,(H,12,13) |
| InChI Key | NYXZLEZAQMDQPX-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.058243149 g/mol |
| Topological Polar Surface Area (TPSA) | 51.50 Ų |
| XlogP | 1.90 |
| 91913-76-7 |
| 1-methoxy-1h-indole-3-carboxylic acid |
| 1-methoxyindole-3-carboxylicacid |
| SCHEMBL22955702 |
| DTXSID00238760 |
| HY-N1635 |
| AKOS006272876 |
| FS-8625 |
| CS-0017296 |
| E80470 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.14% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.84% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.85% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.50% | 85.14% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 86.21% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.03% | 86.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.45% | 93.00% |
| CHEMBL5028 | O14672 | ADAM10 | 82.27% | 97.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.48% | 95.50% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.74% | 94.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.59% | 99.23% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 80.45% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eutrema japonicum |
| PubChem | 124476 |
| LOTUS | LTS0110625 |
| wikiData | Q72490079 |