1-methoxy-9H-carbazole-3-carboxylic acid
| Internal ID | 71348572-66bc-44d2-91bd-ae3e2d071636 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 1-methoxy-9H-carbazole-3-carboxylic acid |
| SMILES (Canonical) | COC1=CC(=CC2=C1NC3=CC=CC=C32)C(=O)O |
| SMILES (Isomeric) | COC1=CC(=CC2=C1NC3=CC=CC=C32)C(=O)O |
| InChI | InChI=1S/C14H11NO3/c1-18-12-7-8(14(16)17)6-10-9-4-2-3-5-11(9)15-13(10)12/h2-7,15H,1H3,(H,16,17) |
| InChI Key | VZOALRHIINZPKX-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 62.30 Ų |
| XlogP | 2.90 |
| 3889-89-2 |
| NSC654276 |
| CHEMBL498081 |
| DTXSID901275954 |
| NSC-654276 |
| NCI60_018840 |
| 9H-Carbazole-3-carboxylic acid, 1-methoxy- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.37% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.48% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.78% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.68% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.52% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.95% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.96% | 99.17% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.96% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.09% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.41% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.40% | 90.00% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 82.72% | 95.48% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.21% | 89.44% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.12% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.11% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Murraya euchrestifolia |
| Murraya koenigii |
| PubChem | 375142 |
| NPASS | NPC184408 |
| ChEMBL | CHEMBL498081 |
| LOTUS | LTS0138272 |
| wikiData | Q105299881 |