1-Methoxy-2-methyl-3-prop-1-en-2-ylbenzene
| Internal ID | 792d0413-0f1c-41bc-a5b1-6438311f9971 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenylpropenes |
| IUPAC Name | 1-methoxy-2-methyl-3-prop-1-en-2-ylbenzene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H14O/c1-8(2)10-6-5-7-11(12-4)9(10)3/h5-7H,1H2,2-4H3 |
| InChI Key | LFJSDOPRELEYLN-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.104465066 g/mol |
| Topological Polar Surface Area (TPSA) | 9.20 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.22% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.43% | 96.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.51% | 95.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.10% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.02% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.00% | 98.75% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.56% | 97.36% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.88% | 90.20% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.45% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.60% | 91.11% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 81.54% | 80.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.06% | 90.24% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.11% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piqueria trinervia |
| PubChem | 89193713 |
| LOTUS | LTS0077349 |
| wikiData | Q105151047 |