1-Methoxy-2-(3-methylbut-2-en-1-yl)-9H-carbazole-3-carbaldehyde
Internal ID | 2312f87c-d30a-4541-9836-8b3f8433c33f |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 1-methoxy-2-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
SMILES (Canonical) | CC(=CCC1=C(C2=C(C=C1C=O)C3=CC=CC=C3N2)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C2=C(C=C1C=O)C3=CC=CC=C3N2)OC)C |
InChI | InChI=1S/C19H19NO2/c1-12(2)8-9-14-13(11-21)10-16-15-6-4-5-7-17(15)20-18(16)19(14)22-3/h4-8,10-11,20H,9H2,1-3H3 |
InChI Key | FRQNYPFNOITCMV-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C19H19NO2 |
Molecular Weight | 293.40 g/mol |
Exact Mass | 293.141578849 g/mol |
Topological Polar Surface Area (TPSA) | 42.10 Ų |
XlogP | 4.70 |
Indizoline |
DTXSID40558434 |
1-Methoxy-2-(3-methylbut-2-en-1-yl)-9H-carbazole-3-carbaldehyde |
1-Methoxy-2-(3-methyl-2-butenyl)-9H-carbazole-3-carbaldehyde |
1-methoxy-2-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
1-meth-oxy-2-(3-methyl-but-2-en-yl)-9h-carbazole-3-carbaldehyde |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.34% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.16% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 94.60% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.54% | 96.09% |
CHEMBL240 | Q12809 | HERG | 93.53% | 89.76% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.82% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.61% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.61% | 96.00% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.25% | 98.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.06% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 87.59% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.53% | 86.33% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.69% | 98.59% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.72% | 99.17% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 83.15% | 89.44% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.98% | 91.71% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.03% | 85.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clausena indica |
Clausena lansium |
PubChem | 14282362 |
LOTUS | LTS0253365 |
wikiData | Q82440739 |