1-Methoxy-2-[3-(4-methoxyphenyl)prop-1-en-2-yl]-4-prop-1-enylbenzene
| Internal ID | f8e9f36d-84f9-435d-b630-f8f932ee932f |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 1-methoxy-2-[3-(4-methoxyphenyl)prop-1-en-2-yl]-4-prop-1-enylbenzene |
| SMILES (Canonical) | CC=CC1=CC(=C(C=C1)OC)C(=C)CC2=CC=C(C=C2)OC |
| SMILES (Isomeric) | CC=CC1=CC(=C(C=C1)OC)C(=C)CC2=CC=C(C=C2)OC |
| InChI | InChI=1S/C20H22O2/c1-5-6-16-9-12-20(22-4)19(14-16)15(2)13-17-7-10-18(21-3)11-8-17/h5-12,14H,2,13H2,1,3-4H3 |
| InChI Key | QQNBBZAVHKOVPU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.161979940 g/mol |
| Topological Polar Surface Area (TPSA) | 18.50 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
![2D Structure of 1-Methoxy-2-[3-(4-methoxyphenyl)prop-1-en-2-yl]-4-prop-1-enylbenzene](https://plantaedb.com/storage/docs/compounds/2023/11/1-methoxy-2-3-4-methoxyphenylprop-1-en-2-yl-4-prop-1-enylbenzene.jpg "2D Structure of 1-Methoxy-2-[3-(4-methoxyphenyl)prop-1-en-2-yl]-4-prop-1-enylbenzene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.14% | 96.09% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 94.98% | 90.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.06% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.54% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 93.15% | 95.50% |
| CHEMBL240 | Q12809 | HERG | 92.73% | 89.76% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.94% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.75% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.38% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.55% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.54% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.39% | 91.49% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 87.30% | 92.51% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.29% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.19% | 95.89% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.89% | 93.31% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.91% | 90.20% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.72% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.58% | 94.45% |
| CHEMBL2216739 | Q92523 | Carnitine O-palmitoyltransferase 1, muscle isoform | 83.06% | 88.33% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.66% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162895196 |
| LOTUS | LTS0045289 |
| wikiData | Q105225937 |