1-Methoxy-10-methyl-acridin-9-one
| Internal ID | 0e31e7a6-b0c5-443d-8f9a-ab94c5fc0d1f |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1-methoxy-10-methylacridin-9-one |
| SMILES (Canonical) | CN1C2=C(C(=CC=C2)OC)C(=O)C3=CC=CC=C31 |
| SMILES (Isomeric) | CN1C2=C(C(=CC=C2)OC)C(=O)C3=CC=CC=C31 |
| InChI | InChI=1S/C15H13NO2/c1-16-11-7-4-3-6-10(11)15(17)14-12(16)8-5-9-13(14)18-2/h3-9H,1-2H3 |
| InChI Key | SCGOHIREVYJYTB-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.094628657 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 3.10 |
| 1-methoxy-10-methyl-acridin-9-one |
| RD6-5075 |
| 1-Methoxy-10-methyl-10-hydroacridin-9-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.41% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.29% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.01% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.69% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.02% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.69% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.63% | 85.14% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 89.06% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.08% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.33% | 96.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 85.63% | 92.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.37% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.74% | 89.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.08% | 90.20% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.78% | 89.62% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.89% | 96.67% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.39% | 94.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Samadera bidwillii |
| PubChem | 468117 |
| LOTUS | LTS0027676 |
| wikiData | Q105250108 |