1-Hydroxymethylindole-3-carboxylic acid
| Internal ID | 08240198-4f8c-416b-9cd9-465adca6d331 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives |
| IUPAC Name | 1-(hydroxymethyl)indole-3-carboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H9NO3/c12-6-11-5-8(10(13)14)7-3-1-2-4-9(7)11/h1-5,12H,6H2,(H,13,14) |
| InChI Key | OCSSNZMNGKCKHC-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.058243149 g/mol |
| Topological Polar Surface Area (TPSA) | 62.50 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.56% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.97% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.37% | 98.95% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.91% | 93.00% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 86.14% | 87.67% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.95% | 94.62% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 85.26% | 100.00% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 84.23% | 95.71% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.13% | 94.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.11% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 84663052 |
| LOTUS | LTS0052396 |
| wikiData | Q104193239 |