1-(Hydroxymethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol
Internal ID | 6c61b6d2-3003-42f0-bdbb-6a529d6d0b38 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 1-(hydroxymethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol |
SMILES (Canonical) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2O)(C)CO)C |
SMILES (Isomeric) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2O)(C)CO)C |
InChI | InChI=1S/C20H30O2/c1-13(2)14-6-7-16-15(10-14)17(22)11-18-19(3,12-21)8-5-9-20(16,18)4/h6-7,10,13,17-18,21-22H,5,8-9,11-12H2,1-4H3 |
InChI Key | PORHOKHIMOFMMH-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C20H30O2 |
Molecular Weight | 302.50 g/mol |
Exact Mass | 302.224580195 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 4.40 |
ACon1_001061 |
CHEBI:181068 |
NCGC00169715-01 |
NCGC00169715-02 |
BRD-A19030701-001-01-3 |
1-(hydroxymethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-9-ol |
NCGC00169715-02_C20H30O2_Abieta-8(14),9(11),12-triene-7,18-diol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.86% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.75% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.08% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.72% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.00% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.27% | 93.99% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.80% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.66% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.29% | 90.71% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.51% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.32% | 90.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.18% | 97.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.51% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.48% | 89.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.13% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.23% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.08% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrus atlantica |
Cedrus deodara |
Larix kaempferi |
Pinus koraiensis |
PubChem | 23786420 |
LOTUS | LTS0218860 |
wikiData | Q105212632 |