4-(Acetyloxy)-alpha-ethenylbenzenemethanol
| Internal ID | d5d59ec3-547c-4d06-ac16-ffd382bf305b |
| Taxonomy | Benzenoids > Phenol esters |
| IUPAC Name | [4-(1-hydroxyprop-2-enyl)phenyl] acetate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H12O3/c1-3-11(13)9-4-6-10(7-5-9)14-8(2)12/h3-7,11,13H,1H2,2H3 |
| InChI Key | GKYVDAMMLMMJGZ-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.078644241 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 1.70 |
| RefChem:288429 |
| 4-(Acetyloxy)-alpha-ethenylbenzenemethanol |
| 1'-Hydroxychavicol acetate |
| [4-(1-hydroxyprop-2-enyl)phenyl] acetate |
| Benzenemethanol, 4-(acetyloxy)-alpha-ethenyl- |
| 4-(1-hydroxyallyl)phenyl acetate |
| 4-(1-HYDROXYPROP-2-EN-1-YL)PHENYL ACETATE |
| 1'-S-1'-Hydroxychavicol acetate |
| CHEBI:173929 |
| DTXSID101284684 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.72% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.02% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.22% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.08% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.39% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.37% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.36% | 94.73% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.17% | 94.80% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.14% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.37% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.28% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alpinia galanga |
| PubChem | 71596738 |
| LOTUS | LTS0075451 |
| wikiData | Q104397190 |