1-Hydroxy-5,6-dimethoxy-7-(3-methylbut-2-enyl)xanthen-9-one
| Internal ID | 0c3e0889-f069-47e3-bb4b-7be949c3af32 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > 2-prenylated xanthones |
| IUPAC Name | 1-hydroxy-5,6-dimethoxy-7-(3-methylbut-2-enyl)xanthen-9-one |
| SMILES (Canonical) | CC(=CCC1=CC2=C(C(=C1OC)OC)OC3=CC=CC(=C3C2=O)O)C |
| SMILES (Isomeric) | CC(=CCC1=CC2=C(C(=C1OC)OC)OC3=CC=CC(=C3C2=O)O)C |
| InChI | InChI=1S/C20H20O5/c1-11(2)8-9-12-10-13-17(22)16-14(21)6-5-7-15(16)25-19(13)20(24-4)18(12)23-3/h5-8,10,21H,9H2,1-4H3 |
| InChI Key | IWAHPMCGADAHBK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.38% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.06% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.41% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.89% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.72% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.51% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.19% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.94% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.62% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.51% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.81% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.77% | 85.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.07% | 92.62% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 83.06% | 89.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.60% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia linii |
| PubChem | 11313801 |
| LOTUS | LTS0193875 |
| wikiData | Q105121426 |