1-hydroxy-3,5,6-trimethoxy-10H-acridin-9-one
| Internal ID | 59f4060e-95ff-4161-b224-58d5149ee715 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 1-hydroxy-3,5,6-trimethoxy-10H-acridin-9-one |
| SMILES (Canonical) | COC1=C(C2=C(C=C1)C(=O)C3=C(N2)C=C(C=C3O)OC)OC |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1)C(=O)C3=C(N2)C=C(C=C3O)OC)OC |
| InChI | InChI=1S/C16H15NO5/c1-20-8-6-10-13(11(18)7-8)15(19)9-4-5-12(21-2)16(22-3)14(9)17-10/h4-7,18H,1-3H3,(H,17,19) |
| InChI Key | BDQCAEJTZSIKFA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09502258 g/mol |
| Topological Polar Surface Area (TPSA) | 77.00 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.69% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.71% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.28% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.57% | 93.99% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 95.13% | 92.68% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.44% | 94.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.28% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.83% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.52% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.80% | 96.09% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.77% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.63% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.74% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.12% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.39% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.68% | 99.17% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.78% | 93.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.62% | 86.33% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.00% | 93.40% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.18% | 92.94% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.03% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus × aurantium |
| PubChem | 13965868 |
| LOTUS | LTS0106536 |
| wikiData | Q104924577 |