1-Hydroxy-3,4,5-trimethoxyxanthone
| Internal ID | 503d98af-52ff-4436-9e80-73b06fabc791 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1-hydroxy-3,4,5-trimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=CC=CC2=C1OC3=C(C2=O)C(=CC(=C3OC)OC)O |
| SMILES (Isomeric) | COC1=CC=CC2=C1OC3=C(C2=O)C(=CC(=C3OC)OC)O |
| InChI | InChI=1S/C16H14O6/c1-19-10-6-4-5-8-13(18)12-9(17)7-11(20-2)15(21-3)16(12)22-14(8)10/h4-7,17H,1-3H3 |
| InChI Key | VXTZMXABRBBPJM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 74.20 Ų |
| XlogP | 3.10 |
| 23251-63-0 |
| 20848-59-3 |
| 1-HYDROXY-3,4,5-TRIMETHOXYXANTHEN-9-ONE |
| 9H-Xanthen-9-one,1-hydroxy-3,4,7-trimethoxy- |
| 9H-Xanthen-9-one, 1-hydroxy-3,4,5-trimethoxy- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.94% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.35% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.55% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.97% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.81% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.74% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.13% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.66% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.09% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.20% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.91% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.75% | 99.17% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.49% | 93.65% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.35% | 85.14% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.81% | 95.50% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.73% | 90.20% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.47% | 94.73% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.85% | 94.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.34% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia dulcis |
| Lomatogonium carinthiacum |
| PubChem | 72944463 |
| LOTUS | LTS0195967 |
| wikiData | Q105298762 |