(1-Hydroxy-3-methyl-5,8-dioxonaphthalen-2-yl) acetate
Internal ID | f24b27a0-483b-4c60-95e3-f78da9438731 |
Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
IUPAC Name | (1-hydroxy-3-methyl-5,8-dioxonaphthalen-2-yl) acetate |
SMILES (Canonical) | CC1=CC2=C(C(=O)C=CC2=O)C(=C1OC(=O)C)O |
SMILES (Isomeric) | CC1=CC2=C(C(=O)C=CC2=O)C(=C1OC(=O)C)O |
InChI | InChI=1S/C13H10O5/c1-6-5-8-9(15)3-4-10(16)11(8)12(17)13(6)18-7(2)14/h3-5,17H,1-2H3 |
InChI Key | DPJWCBWHDYAVDR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H10O5 |
Molecular Weight | 246.21 g/mol |
Exact Mass | 246.05282342 g/mol |
Topological Polar Surface Area (TPSA) | 80.70 Ų |
XlogP | 1.80 |
There are no found synonyms. |
![2D Structure of (1-Hydroxy-3-methyl-5,8-dioxonaphthalen-2-yl) acetate 2D Structure of (1-Hydroxy-3-methyl-5,8-dioxonaphthalen-2-yl) acetate](https://plantaedb.com/storage/docs/compounds/2023/11/1-hydroxy-3-methyl-58-dioxonaphthalen-2-yl-acetate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.55% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.65% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.28% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.93% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.17% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.82% | 86.33% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.79% | 97.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.61% | 90.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.00% | 95.64% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.39% | 96.95% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.78% | 96.67% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.28% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.39% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.47% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dianella revoluta |
PubChem | 162875115 |
LOTUS | LTS0082306 |
wikiData | Q104986542 |