1-Hydroxy-2,3-dimethylanthracene-9,10-dione
| Internal ID | 46bdc663-e54d-43dc-aeda-4f5343e1473d |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | 1-hydroxy-2,3-dimethylanthracene-9,10-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H12O3/c1-8-7-12-13(14(17)9(8)2)16(19)11-6-4-3-5-10(11)15(12)18/h3-7,17H,1-2H3 |
| InChI Key | GARRKQYRNXWAAS-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.078644241 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | 3.80 |
| 147088-69-5 |
| 61231-62-7 |
| 9,10-Anthracenedione, 1-hydroxydimethyl- |
| 1-HYDROXY-2,3-DIMETHYL-ANTHRAQUINONE |
| DTXSID00274305 |
| 1-hydroxyl-2,3-dimethylanthraquinone |
| AKOS024341724 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.00% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.69% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.82% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.65% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.19% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.93% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.09% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.80% | 99.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.91% | 93.65% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.87% | 96.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.91% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.17% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.25% | 96.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.14% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gynochthodes officinalis |
| PubChem | 1382 |
| LOTUS | LTS0219595 |
| wikiData | Q82003681 |