1-Hydroxy-2,10,11-trimethoxynoraporphine
| Internal ID | 196d787d-a704-41b6-9ce6-39da029ea615 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 2,10,11-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| SMILES (Canonical) | COC1=C(C2=C(CC3C4=C2C(=C(C=C4CCN3)OC)O)C=C1)OC |
| SMILES (Isomeric) | COC1=C(C2=C(CC3C4=C2C(=C(C=C4CCN3)OC)O)C=C1)OC |
| InChI | InChI=1S/C19H21NO4/c1-22-13-5-4-10-8-12-15-11(6-7-20-12)9-14(23-2)18(21)17(15)16(10)19(13)24-3/h4-5,9,12,20-21H,6-8H2,1-3H3 |
| InChI Key | HVMMFGYMZZVURQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 60.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.45% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.62% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.50% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.94% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.63% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 92.55% | 95.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.48% | 97.09% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.83% | 92.68% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.97% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.91% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.85% | 95.89% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.22% | 88.48% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.71% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.45% | 92.94% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.00% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.33% | 94.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.89% | 89.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.46% | 98.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.07% | 91.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.54% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.44% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Annona muricata |
| Annona squamosa |
| Chelidonium majus |
| Corydalis stricta |
| Glaucium fimbrilligerum |
| Laureliopsis philippiana |
| PubChem | 78172954 |
| LOTUS | LTS0149244 |
| wikiData | Q105034355 |