1-hydroperoxy-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one
Internal ID | d436647c-0ad1-4b2c-a19f-f2a9c0bbcef3 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 1-hydroperoxy-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
SMILES (Canonical) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2=O)(C)OO)C |
SMILES (Isomeric) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2=O)(C)OO)C |
InChI | InChI=1S/C19H26O3/c1-12(2)13-6-7-15-14(10-13)16(20)11-17-18(15,3)8-5-9-19(17,4)22-21/h6-7,10,12,17,21H,5,8-9,11H2,1-4H3 |
InChI Key | TXROUTHBEADSBS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H26O3 |
Molecular Weight | 302.40 g/mol |
Exact Mass | 302.18819469 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.00 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.63% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.67% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.39% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.20% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.36% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.75% | 82.69% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.61% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.37% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.56% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.28% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 84.99% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.84% | 90.71% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.65% | 93.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.52% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.66% | 89.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.58% | 91.19% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.71% | 91.07% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.47% | 94.80% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.45% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.44% | 97.25% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.19% | 95.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.09% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juniperus chinensis |
PubChem | 163022832 |
LOTUS | LTS0114119 |
wikiData | Q105266963 |