1-epi-Tatridin B
Internal ID | 30478f03-47f6-49c6-863b-8d47f5df4ba3 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (3aS,4R,5E,9S,11aS)-4,9-dihydroxy-6-methyl-3,10-dimethylidene-4,7,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-2-one |
SMILES (Canonical) | CC1=CC(C2C(CC(=C)C(CC1)O)OC(=O)C2=C)O |
SMILES (Isomeric) | C/C/1=C\[C@H]([C@H]2[C@H](CC(=C)[C@H](CC1)O)OC(=O)C2=C)O |
InChI | InChI=1S/C15H20O4/c1-8-4-5-11(16)9(2)7-13-14(12(17)6-8)10(3)15(18)19-13/h6,11-14,16-17H,2-5,7H2,1H3/b8-6+/t11-,12+,13-,14-/m0/s1 |
InChI Key | KNEQPJSDSYNUHP-YWKGGISCSA-N |
Popularity | 18 references in papers |
Molecular Formula | C15H20O4 |
Molecular Weight | 264.32 g/mol |
Exact Mass | 264.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 0.80 |
tanachin |
1alpha-hydroxy-1-desoxotamirin |
CHEBI:74113 |
tatridin B |
CHEMBL430091 |
(3aS,4R,5E,9S,11aS)-4,9-dihydroxy-6-methyl-3,10-dimethylidene-4,7,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-2-one |
Q27144423 |
(3aS*,4R*,5E,9S*,11aS*)-4,9-dihydroxy-6-methyl-3,10-bis(methylene)-3a,4,7,8,9,10,11,11a-octahydrocyclodeca[b]furan-2(3H)-one |
(3aS*,4R*,5E,9S*,11aS*)-4,9-dihydroxy-6-methyl-3,10-dimethylidene-4,7,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-2-one |
(3aS,4R,5E,9S,11aS)-4,9-dihydroxy-6-methyl-3,10-bis(methylene)-3a,4,7,8,9,10,11,11a-octahydrocyclodeca[b]furan-2(3H)-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.70% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.63% | 99.23% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.01% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.64% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.46% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.87% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.26% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 82.08% | 98.95% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.90% | 93.03% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.85% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 7605278 |
NPASS | NPC191476 |
ChEMBL | CHEMBL430091 |
LOTUS | LTS0222377 |
wikiData | Q27144423 |