1-Cyclopentylhexacosan-4-one
Internal ID | 8322eb05-3a0c-4b89-a15d-c9e285797930 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Ketones |
IUPAC Name | 1-cyclopentylhexacosan-4-one |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCCCCC(=O)CCCC1CCCC1 |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCCCCC(=O)CCCC1CCCC1 |
InChI | InChI=1S/C31H60O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28-31(32)29-24-27-30-25-22-23-26-30/h30H,2-29H2,1H3 |
InChI Key | JDCUYANHWUVPEM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H60O |
Molecular Weight | 448.80 g/mol |
Exact Mass | 448.464416533 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 14.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.54% | 97.25% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.23% | 89.63% |
CHEMBL2581 | P07339 | Cathepsin D | 95.53% | 98.95% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.15% | 95.17% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.64% | 94.45% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.29% | 100.00% |
CHEMBL240 | Q12809 | HERG | 91.92% | 89.76% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.83% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.46% | 99.17% |
CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 90.57% | 98.57% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.06% | 93.56% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 90.04% | 90.24% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 89.45% | 85.94% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.93% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.79% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.18% | 82.69% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.87% | 91.81% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.22% | 97.29% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.09% | 98.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.69% | 91.11% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.01% | 100.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.87% | 93.04% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 82.86% | 95.27% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.36% | 92.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.76% | 91.19% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.01% | 96.61% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.90% | 96.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.66% | 93.03% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.54% | 92.08% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.34% | 92.86% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.11% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia macrophylla |
PubChem | 14132245 |
LOTUS | LTS0043563 |
wikiData | Q105125374 |