1-(alpha-d-Arabinofuranosyl)uracil
Internal ID | b8968709-668a-4d2f-87ab-06d62190abc5 |
Taxonomy | Nucleosides, nucleotides, and analogues > Pyrimidine nucleosides |
IUPAC Name | 1-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
SMILES (Canonical) | C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
SMILES (Isomeric) | C1=CN(C(=O)NC1=O)[C@@H]2[C@H]([C@@H]([C@H](O2)CO)O)O |
InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7+,8+/m1/s1 |
InChI Key | DRTQHJPVMGBUCF-GVYWOMJSSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C9H12N2O6 |
Molecular Weight | 244.20 g/mol |
Exact Mass | 244.06953611 g/mol |
Topological Polar Surface Area (TPSA) | 119.00 Ų |
XlogP | -2.00 |
1-(alpha-d-arabinofuranosyl)uracil |
TNP00243 |
NCGC00017312-01 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.41% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.47% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.94% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 92.85% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.17% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.88% | 94.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.44% | 91.11% |
CHEMBL2123 | P51582 | Pyrimidinergic receptor P2Y4 | 82.79% | 93.39% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 81.49% | 98.59% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.99% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.72% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lepisorus contortus |
PubChem | 6604651 |
LOTUS | LTS0256545 |
wikiData | Q104987636 |