1-Acetyl-3,14,20-trihydroxywitha-5,24-dienolide 3-glucoside
Internal ID | e8806fb4-2fcd-450b-aae5-a3cc9cb24370 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives > Withanolide glycosides and derivatives |
IUPAC Name | [17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-14-hydroxy-10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] acetate |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3(C2(CCC4C3CC=C5C4(C(CC(C5)OC6C(C(C(C(O6)CO)O)O)O)OC(=O)C)C)C)O)O)C |
SMILES (Isomeric) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3(C2(CCC4C3CC=C5C4(C(CC(C5)OC6C(C(C(C(O6)CO)O)O)O)OC(=O)C)C)C)O)O)C |
InChI | InChI=1S/C36H54O12/c1-17-13-27(48-31(42)18(17)2)35(6,43)25-10-12-36(44)23-8-7-20-14-21(46-32-30(41)29(40)28(39)24(16-37)47-32)15-26(45-19(3)38)34(20,5)22(23)9-11-33(25,36)4/h7,21-30,32,37,39-41,43-44H,8-16H2,1-6H3 |
InChI Key | ACXRDVCAKSUCPM-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C36H54O12 |
Molecular Weight | 678.80 g/mol |
Exact Mass | 678.36152715 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 1.60 |
CHEBI:168690 |
[17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-14-hydroxy-10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] acetate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.08% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.52% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.22% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.27% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.79% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.27% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.23% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.66% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.89% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.05% | 93.04% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.93% | 91.07% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.87% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.40% | 97.14% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.07% | 90.08% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.81% | 93.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.77% | 94.75% |
CHEMBL5028 | O14672 | ADAM10 | 85.52% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.07% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.15% | 99.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.73% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.63% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.22% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 80.89% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis peruviana |
PubChem | 85262501 |
LOTUS | LTS0074544 |
wikiData | Q104909375 |