1'-Acetoxychavicol Acetate
| Internal ID | d5bc362d-cd34-487b-9851-ba2277963020 |
| Taxonomy | Benzenoids > Phenol esters |
| IUPAC Name | [4-[(1S)-1-acetyloxyprop-2-enyl]phenyl] acetate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H14O4/c1-4-13(17-10(3)15)11-5-7-12(8-6-11)16-9(2)14/h4-8,13H,1H2,2-3H3/t13-/m0/s1 |
| InChI Key | JAMQIUWGGBSIKZ-ZDUSSCGKSA-N |
| Popularity | 93 references in papers |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 2.20 |
| 52946-22-2 |
| [4-[(1S)-1-acetyloxyprop-2-enyl]phenyl] acetate |
| CHEBI:469 |
| SQV3080A20 |
| (alphaS)-4-(Acetyloxy)-alpha-ethenylbenzenemethanol |
| Benzenemethanol, 4-(acetyloxy)-alpha-ethenyl-, acetate, (S)- |
| (4-((1S)-1-acetyloxyprop-2-enyl)phenyl) acetate |
| RefChem:408790 |
| D,L-1'-Acetoxychavicol acetate |
| 1'-Acetoxychavicol |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.93% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.30% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.94% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.25% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.99% | 94.45% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.13% | 94.80% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.83% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.36% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.69% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alpinia conchigera |
| Alpinia galanga |
| PubChem | 119104 |
| NPASS | NPC88868 |
| ChEMBL | CHEMBL323727 |
| LOTUS | LTS0153905 |
| wikiData | Q27070798 |