1-[7-Hydroxy-5-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]-3-phenylprop-2-en-1-one
Internal ID | e4c91b52-4b63-4910-805b-49301b1d6536 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | 1-[7-hydroxy-5-methoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]-3-phenylprop-2-en-1-one |
SMILES (Canonical) | CC(=CCCC1(C=CC2=C(C=C(C(=C2O1)C(=O)C=CC3=CC=CC=C3)O)OC)C)C |
SMILES (Isomeric) | CC(=CCCC1(C=CC2=C(C=C(C(=C2O1)C(=O)C=CC3=CC=CC=C3)O)OC)C)C |
InChI | InChI=1S/C26H28O4/c1-18(2)9-8-15-26(3)16-14-20-23(29-4)17-22(28)24(25(20)30-26)21(27)13-12-19-10-6-5-7-11-19/h5-7,9-14,16-17,28H,8,15H2,1-4H3 |
InChI Key | CTWSWRSNFKNYMF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O4 |
Molecular Weight | 404.50 g/mol |
Exact Mass | 404.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 6.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.17% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.17% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.70% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.00% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.71% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 92.45% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.09% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.99% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 91.54% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.08% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.29% | 85.14% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 86.42% | 90.20% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.92% | 93.99% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.97% | 90.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.99% | 89.50% |
CHEMBL5028 | O14672 | ADAM10 | 81.12% | 97.50% |
CHEMBL2535 | P11166 | Glucose transporter | 80.53% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boesenbergia rotunda |
Datura innoxia |
Duboisia myoporoides |
Hyoscyamus pusillus |
Physochlaina alaica |
PubChem | 5256732 |
LOTUS | LTS0173739 |
wikiData | Q105129766 |