1-(6-Oxo-2,3-dihydropyran-2-yl)hept-4-en-2-yl acetate
Internal ID | e5169eaa-25c8-4513-87bd-6aff373d731b |
Taxonomy | Organoheterocyclic compounds > Pyrans > Pyranones and derivatives > Dihydropyranones |
IUPAC Name | 1-(6-oxo-2,3-dihydropyran-2-yl)hept-4-en-2-yl acetate |
SMILES (Canonical) | CCC=CCC(CC1CC=CC(=O)O1)OC(=O)C |
SMILES (Isomeric) | CCC=CCC(CC1CC=CC(=O)O1)OC(=O)C |
InChI | InChI=1S/C14H20O4/c1-3-4-5-7-12(17-11(2)15)10-13-8-6-9-14(16)18-13/h4-6,9,12-13H,3,7-8,10H2,1-2H3 |
InChI Key | YKAIEQJKNLRONE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H20O4 |
Molecular Weight | 252.31 g/mol |
Exact Mass | 252.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 52.60 Ų |
XlogP | 2.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 92.06% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.93% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.86% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.72% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.14% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.71% | 91.11% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.88% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.71% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.67% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.06% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.40% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.49% | 86.33% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.38% | 94.80% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.13% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Castanopsis fissa |
Cryptocarya latifolia |
Osbeckia chinensis |
Platycarya strobilacea |
PubChem | 162908381 |
LOTUS | LTS0223135 |
wikiData | Q104960717 |