1-[6-(2-Hydroxybutyl)piperidin-2-yl]hexan-2-ol
| Internal ID | f9c4959f-b06f-4af6-9d47-45504c72e5d2 |
| Taxonomy | Organoheterocyclic compounds > Piperidines |
| IUPAC Name | 1-[6-(2-hydroxybutyl)piperidin-2-yl]hexan-2-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H31NO2/c1-3-5-9-15(18)11-13-8-6-7-12(16-13)10-14(17)4-2/h12-18H,3-11H2,1-2H3 |
| InChI Key | RXJHXBORQMLXBV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.235479232 g/mol |
| Topological Polar Surface Area (TPSA) | 52.50 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of 1-[6-(2-Hydroxybutyl)piperidin-2-yl]hexan-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1-6-2-hydroxybutylpiperidin-2-ylhexan-2-ol.jpg "2D Structure of 1-[6-(2-Hydroxybutyl)piperidin-2-yl]hexan-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.14% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.20% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.87% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.18% | 97.09% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 91.97% | 97.64% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 90.38% | 92.88% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.45% | 100.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.60% | 91.81% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.23% | 92.86% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.70% | 93.56% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.63% | 95.56% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.14% | 97.29% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.10% | 98.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.73% | 93.31% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.50% | 85.94% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.41% | 93.18% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 84.28% | 97.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.75% | 94.45% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.16% | 96.47% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.78% | 97.50% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 82.45% | 98.35% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 82.07% | 95.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.01% | 99.18% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.73% | 95.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.45% | 100.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.26% | 97.64% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.97% | 99.17% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.49% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.47% | 95.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.31% | 82.69% |
| CHEMBL268 | P43235 | Cathepsin K | 80.09% | 96.85% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Andrachne aspera |
| Celastrus orbiculatus |
| PubChem | 14760902 |
| LOTUS | LTS0132387 |
| wikiData | Q103787576 |