1-[5-(3,7-Dimethylocta-2,6-dienyl)-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one
Internal ID | c8ac3988-1092-4cdc-8ec4-36e19ab4d5c3 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 3-prenylated chalcones |
IUPAC Name | 1-[5-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | CC(=CCCC(=CCC1=CC(=C(C=C1O)O)C(=O)C=CC2=CC=C(C=C2)O)C)C |
SMILES (Isomeric) | CC(=CCCC(=CCC1=CC(=C(C=C1O)O)C(=O)C=CC2=CC=C(C=C2)O)C)C |
InChI | InChI=1S/C25H28O4/c1-17(2)5-4-6-18(3)7-11-20-15-22(25(29)16-24(20)28)23(27)14-10-19-8-12-21(26)13-9-19/h5,7-10,12-16,26,28-29H,4,6,11H2,1-3H3 |
InChI Key | RRYKPKZXWKXEML-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H28O4 |
Molecular Weight | 392.50 g/mol |
Exact Mass | 392.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 7.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 93.34% | 92.51% |
CHEMBL2581 | P07339 | Cathepsin D | 93.28% | 98.95% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.08% | 93.10% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.74% | 86.33% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.63% | 92.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.36% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.98% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.52% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.07% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.29% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.19% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 83.92% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 83.68% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.86% | 90.71% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.18% | 85.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.84% | 95.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.61% | 91.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.16% | 90.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 80.92% | 96.12% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.07% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 91431621 |
LOTUS | LTS0120863 |
wikiData | Q105244446 |