1-[5-(1H-indol-3-yl)-1,3-oxazol-2-yl]propan-1-ol
| Internal ID | 176eda32-85f8-4572-8565-92372cf18b4d |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles |
| IUPAC Name | 1-[5-(1H-indol-3-yl)-1,3-oxazol-2-yl]propan-1-ol |
| SMILES (Canonical) | CCC(C1=NC=C(O1)C2=CNC3=CC=CC=C32)O |
| SMILES (Isomeric) | CCC(C1=NC=C(O1)C2=CNC3=CC=CC=C32)O |
| InChI | InChI=1S/C14H14N2O2/c1-2-12(17)14-16-8-13(18-14)10-7-15-11-6-4-3-5-9(10)11/h3-8,12,15,17H,2H2,1H3 |
| InChI Key | IMZVEWFESRNTEX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.105527694 g/mol |
| Topological Polar Surface Area (TPSA) | 62.00 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.81% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.34% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.69% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.15% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.94% | 89.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.25% | 95.56% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 89.11% | 93.65% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.87% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.62% | 98.75% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 87.16% | 88.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.89% | 94.73% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.84% | 94.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.82% | 95.56% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.28% | 87.45% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 82.18% | 93.81% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.71% | 96.67% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.49% | 97.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.65% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72663847 |
| LOTUS | LTS0137115 |
| wikiData | Q104168934 |