1-(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbutan-2-ol
| Internal ID | 7475f940-d508-4a2d-b2a9-4bbc473d3888 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | 1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbutan-2-ol |
| SMILES (Canonical) | CC(C)C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O |
| SMILES (Isomeric) | CC(C)C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O |
| InChI | InChI=1S/C18H21NO5/c1-10(2)13(20)9-24-14-6-5-11-15(17(14)22-4)19-18-12(7-8-23-18)16(11)21-3/h5-8,10,13,20H,9H2,1-4H3 |
| InChI Key | SMSBSJNIBCNVES-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.14197277 g/mol |
| Topological Polar Surface Area (TPSA) | 74.00 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of 1-(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbutan-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1-48-dimethoxyfuro23-bquinolin-7-yloxy-3-methylbutan-2-ol.jpg "2D Structure of 1-(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbutan-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.74% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.49% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.90% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.01% | 83.82% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.92% | 94.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 89.01% | 95.12% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.67% | 99.17% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 85.37% | 94.03% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.35% | 95.56% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.97% | 96.67% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.77% | 92.98% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.67% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.40% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.19% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.83% | 86.33% |
| CHEMBL290 | Q13370 | Phosphodiesterase 3B | 81.13% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.64% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.64% | 95.56% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.60% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplophyllum ferganicum |
| PubChem | 163026272 |
| LOTUS | LTS0036173 |
| wikiData | Q105256140 |