[1-(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-2-hydroxy-3-methylbutyl] acetate
| Internal ID | d8b1ddca-aae6-4de6-9e54-b5097824038b |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | [1-(4,8-dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-2-hydroxy-3-methylbutyl] acetate |
| SMILES (Canonical) | CC(C)C(C(OC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)OC(=O)C)O |
| SMILES (Isomeric) | CC(C)C(C(OC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)OC(=O)C)O |
| InChI | InChI=1S/C20H23NO7/c1-10(2)16(23)20(27-11(3)22)28-14-7-6-12-15(18(14)25-5)21-19-13(8-9-26-19)17(12)24-4/h6-10,16,20,23H,1-5H3 |
| InChI Key | GVNWBELMQDFVHC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.14745207 g/mol |
| Topological Polar Surface Area (TPSA) | 100.00 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
![2D Structure of [1-(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-2-hydroxy-3-methylbutyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/1-48-dimethoxyfuro23-bquinolin-7-yloxy-2-hydroxy-3-methylbutyl-acetate.jpg "2D Structure of [1-(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy-2-hydroxy-3-methylbutyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.47% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.05% | 83.82% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.82% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.62% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.03% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.69% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.59% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.01% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.80% | 95.56% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.53% | 92.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.83% | 93.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.42% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.58% | 99.17% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.62% | 96.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.58% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplophyllum ferganicum |
| PubChem | 162900042 |
| LOTUS | LTS0239998 |
| wikiData | Q105021466 |