1-(4,4,7a-Trimethyl-2,4,5,7a-tetrahydro-1-benzofuran-2-yl)ethan-1-ol
Internal ID | 557f6103-b0c1-4145-a097-7b46b620ac57 |
Taxonomy | Organoheterocyclic compounds > Benzofurans |
IUPAC Name | 1-(4,4,7a-trimethyl-2,5-dihydro-1-benzofuran-2-yl)ethanol |
SMILES (Canonical) | CC(C1C=C2C(CC=CC2(O1)C)(C)C)O |
SMILES (Isomeric) | CC(C1C=C2C(CC=CC2(O1)C)(C)C)O |
InChI | InChI=1S/C13H20O2/c1-9(14)10-8-11-12(2,3)6-5-7-13(11,4)15-10/h5,7-10,14H,6H2,1-4H3 |
InChI Key | MGXXOIZXJCPUJG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H20O2 |
Molecular Weight | 208.30 g/mol |
Exact Mass | 208.146329876 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 1.90 |
1-(4,4,7a-Trimethyl-2,4,5,7a-tetrahydro-1-benzofuran-2-yl)ethan-1-ol |
1-(4,4,7a-trimethyl-2,5-dihydro-1-benzofuran-2-yl)ethanol |
DTXSID20574137 |
DTXSID901183024 |
2,4,5,7a-Tetrahydro-alpha,4,4,7a-tetramethyl-2-benzofuranmethanol |
83709-83-5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.40% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.04% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.08% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.10% | 85.14% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.90% | 92.88% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.50% | 83.82% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.77% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.30% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.22% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.81% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.57% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitis vinifera |
PubChem | 15558328 |
LOTUS | LTS0032720 |
wikiData | Q82463073 |