1-(4-Methoxyphenyl)ethanol
| Internal ID | e76914c9-b5f4-4c90-b41e-687bca201b8e |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 1-(4-methoxyphenyl)ethanol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H12O2/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7,10H,1-2H3 |
| InChI Key | IUUULXXWNYKJSL-UHFFFAOYSA-N |
| Popularity | 136 references in papers |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.083729621 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 1.80 |
| 3319-15-1 |
| 4-Methoxy-alpha-methylbenzyl alcohol |
| 1-(4-methoxyphenyl)ethan-1-ol |
| 4-Methoxyphenyl methyl carbinol |
| 1-(p-Methoxyphenyl)ethanol |
| MFCD00016857 |
| 4-Methoxy-.alpha.-methylbenzyl alcohol |
| 1-(4-methoxyphenyl)-ethanol |
| (+/-)-1-(4-methoxyphenyl)ethanol |
| 018M85FD11 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.98% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.54% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.61% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.20% | 85.14% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.03% | 93.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.91% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.35% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.07% | 90.24% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.76% | 99.15% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.39% | 96.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.64% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101148 |
| LOTUS | LTS0094397 |
| wikiData | Q27159251 |