1-(4-Methoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol
| Internal ID | ead6668d-1036-4ba7-b6de-2ad00dfcc073 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | 1-(4-methoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol |
| SMILES (Canonical) | CC(=C)C(COC1=CC2=C(C=C1)C(=C3C=COC3=N2)OC)O |
| SMILES (Isomeric) | CC(=C)C(COC1=CC2=C(C=C1)C(=C3C=COC3=N2)OC)O |
| InChI | InChI=1S/C17H17NO4/c1-10(2)15(19)9-22-11-4-5-12-14(8-11)18-17-13(6-7-21-17)16(12)20-3/h4-8,15,19H,1,9H2,2-3H3 |
| InChI Key | LLQDFWJDFRTFGW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.11575802 g/mol |
| Topological Polar Surface Area (TPSA) | 64.70 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of 1-(4-Methoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/1-4-methoxyfuro23-bquinolin-7-yloxy-3-methylbut-3-en-2-ol.jpg "2D Structure of 1-(4-Methoxyfuro[2,3-b]quinolin-7-yl)oxy-3-methylbut-3-en-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.82% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.91% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.42% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.08% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.61% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.13% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.06% | 96.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 90.40% | 95.12% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.08% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.92% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.51% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.42% | 98.95% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 86.25% | 95.39% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.85% | 92.68% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.59% | 95.83% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.82% | 93.31% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.32% | 99.15% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.97% | 93.65% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.61% | 92.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.29% | 98.75% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.72% | 96.67% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.51% | 100.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.78% | 93.81% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.56% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.47% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Melicope semecarpifolia |
| PubChem | 10402471 |
| LOTUS | LTS0200513 |
| wikiData | Q105153665 |