1-[4-Methoxy-3-(3-methylbuta-1,3-dienyl)phenyl]ethyl 3-methylbut-2-enoate
| Internal ID | 016a196d-85a4-49d5-9b25-87b7f228bbf1 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzyloxycarbonyls |
| IUPAC Name | 1-[4-methoxy-3-(3-methylbuta-1,3-dienyl)phenyl]ethyl 3-methylbut-2-enoate |
| SMILES (Canonical) | CC(C1=CC(=C(C=C1)OC)C=CC(=C)C)OC(=O)C=C(C)C |
| SMILES (Isomeric) | CC(C1=CC(=C(C=C1)OC)C=CC(=C)C)OC(=O)C=C(C)C |
| InChI | InChI=1S/C19H24O3/c1-13(2)7-8-17-12-16(9-10-18(17)21-6)15(5)22-19(20)11-14(3)4/h7-12,15H,1H2,2-6H3 |
| InChI Key | PRWUBGUSQIBSRO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17254462 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.43% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.14% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.01% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.93% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.52% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.81% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.39% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.11% | 90.20% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.58% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.09% | 89.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.73% | 89.50% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.88% | 83.82% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.76% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.57% | 85.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.45% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.97% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calea hymenolepis |
| PubChem | 163020211 |
| LOTUS | LTS0084269 |
| wikiData | Q105213955 |