1-(4-Hydroxyphenyl)-2-(4-prop-1-enylphenoxy)propan-1-one
| Internal ID | b24a72c2-0b53-46e6-a04e-31f8fec004a1 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
| IUPAC Name | 1-(4-hydroxyphenyl)-2-(4-prop-1-enylphenoxy)propan-1-one |
| SMILES (Canonical) | CC=CC1=CC=C(C=C1)OC(C)C(=O)C2=CC=C(C=C2)O |
| SMILES (Isomeric) | CC=CC1=CC=C(C=C1)OC(C)C(=O)C2=CC=C(C=C2)O |
| InChI | InChI=1S/C18H18O3/c1-3-4-14-5-11-17(12-6-14)21-13(2)18(20)15-7-9-16(19)10-8-15/h3-13,19H,1-2H3 |
| InChI Key | KHCGTBDEZIKXLU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.24% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.90% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.57% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.45% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.87% | 100.00% |
| CHEMBL3194 | P02766 | Transthyretin | 88.80% | 90.71% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 88.06% | 94.97% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.55% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.10% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.84% | 98.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.12% | 93.31% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 83.57% | 98.35% |
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 82.47% | 98.33% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 82.24% | 92.51% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.23% | 98.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.52% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.69% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Caryodaphnopsis baviensis |
| PubChem | 85754270 |
| LOTUS | LTS0137266 |
| wikiData | Q105141090 |