1-(4-Hydroxybenzyl)-4,7-dimethoxy-9,10-dihydrophenanthrene-2-ol
| Internal ID | 96ee968b-7e47-4191-86c0-6d397032bf16 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 1-[(4-hydroxyphenyl)methyl]-4,7-dimethoxy-9,10-dihydrophenanthren-2-ol |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(C=C(C(=C3CC2)CC4=CC=C(C=C4)O)O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(C=C(C(=C3CC2)CC4=CC=C(C=C4)O)O)OC |
| InChI | InChI=1S/C23H22O4/c1-26-17-8-10-18-15(12-17)5-9-19-20(11-14-3-6-16(24)7-4-14)21(25)13-22(27-2)23(18)19/h3-4,6-8,10,12-13,24-25H,5,9,11H2,1-2H3 |
| InChI Key | SZJDORGDYSBBEW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.15180918 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 5.00 |
| 1-[(4-hydroxyphenyl)methyl]-4,7-dimethoxy-9,10-dihydrophenanthren-2-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.49% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.14% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.78% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.63% | 98.95% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.00% | 91.79% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 94.92% | 98.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.78% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.60% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.55% | 98.75% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 92.66% | 96.76% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 92.35% | 98.44% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.99% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.98% | 95.89% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.10% | 95.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.76% | 94.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.52% | 93.40% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 89.41% | 95.12% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.03% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.88% | 86.33% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 86.45% | 96.09% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 85.14% | 97.03% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.83% | 95.93% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.46% | 99.15% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.68% | 95.53% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.86% | 93.31% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.08% | 91.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.97% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.83% | 97.09% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 81.31% | 91.96% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.48% | 96.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.47% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bletilla formosana |
| Pleione formosana |
| PubChem | 11523381 |
| LOTUS | LTS0074617 |
| wikiData | Q105264154 |