1-(4-Hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one
Internal ID | 27feda8d-91b6-41c0-b79f-4b1e9a8d47f6 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)CCC(=O)C=CCCC2=CC(=C(C=C2)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)CCC(=O)C=CCCC2=CC(=C(C=C2)O)OC |
InChI | InChI=1S/C22H26O6/c1-26-19-12-15(9-11-18(19)24)6-4-5-7-17(23)10-8-16-13-20(27-2)22(25)21(14-16)28-3/h5,7,9,11-14,24-25H,4,6,8,10H2,1-3H3 |
InChI Key | GCCMDTDROAUVAS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H26O6 |
Molecular Weight | 386.40 g/mol |
Exact Mass | 386.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 3.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.79% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.22% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.56% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.91% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.46% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.15% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.09% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.31% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.28% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 84.06% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.22% | 92.62% |
CHEMBL3194 | P02766 | Transthyretin | 81.81% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.45% | 95.50% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.97% | 90.20% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.45% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.11% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 78385134 |
LOTUS | LTS0077863 |
wikiData | Q105006199 |