1-(4-Hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)-3,5-heptanediol
Internal ID | 07f11b91-c216-4c58-869b-06f887f1a095 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids > Curcuminoids |
IUPAC Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)CCC(CC(CCC2=CC(=C(C=C2)O)OC)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)CCC(CC(CCC2=CC(=C(C=C2)O)OC)O)O |
InChI | InChI=1S/C22H30O7/c1-27-19-10-14(6-9-18(19)25)4-7-16(23)13-17(24)8-5-15-11-20(28-2)22(26)21(12-15)29-3/h6,9-12,16-17,23-26H,4-5,7-8,13H2,1-3H3 |
InChI Key | UEKHBUNMFZUBFK-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C22H30O7 |
Molecular Weight | 406.50 g/mol |
Exact Mass | 406.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 3.20 |
1-(4-Hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)-3,5-heptanediol |
1-(4-HYDROXY-3,5-DIMETHOXYPHENYL)-7-(4-HYDROXY-3-METHOXYPHENYL)HEPTANE-3,5-DIOL |
CHEBI:176008 |
3,5-dihydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)heptane |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.36% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.64% | 98.95% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.18% | 95.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.13% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.21% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.26% | 86.33% |
CHEMBL1907 | P15144 | Aminopeptidase N | 87.29% | 93.31% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 86.09% | 90.20% |
CHEMBL2535 | P11166 | Glucose transporter | 85.86% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.75% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.33% | 92.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.52% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.45% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.83% | 90.71% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 81.66% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.40% | 95.89% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.32% | 90.24% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.87% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 53462009 |
LOTUS | LTS0153120 |
wikiData | Q105270970 |