1-(4-Hydroxy-3-methoxyphenyl)nonadec-2-en-1-one
Internal ID | 831380dc-7843-4324-b59a-e157d5384e8e |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)nonadec-2-en-1-one |
SMILES (Canonical) | CCCCCCCCCCCCCCCCC=CC(=O)C1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCC=CC(=O)C1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C26H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(27)23-20-21-25(28)26(22-23)29-2/h18-22,28H,3-17H2,1-2H3 |
InChI Key | ZAOISMIRRILCCH-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H42O3 |
Molecular Weight | 402.60 g/mol |
Exact Mass | 402.31339520 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 9.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.70% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.49% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.98% | 86.33% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.63% | 92.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.96% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.80% | 96.95% |
CHEMBL2581 | P07339 | Cathepsin D | 88.77% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 87.89% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.72% | 95.56% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 85.46% | 90.20% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.26% | 90.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.59% | 93.31% |
CHEMBL2535 | P11166 | Glucose transporter | 84.33% | 98.75% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.19% | 89.62% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 82.36% | 98.11% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.76% | 97.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.75% | 96.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.18% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 72996940 |
LOTUS | LTS0212627 |
wikiData | Q105369978 |