1-(4'-Hydroxy-3'-methoxyphenyl)-7-methoxy-2,3-dimethylnaphthalen-6-ol
| Internal ID | 8030c20d-f054-4a73-9e34-133f32d39249 |
| Taxonomy | Lignans, neolignans and related compounds > Arylnaphthalene lignans |
| IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethylnaphthalen-2-ol |
| SMILES (Canonical) | CC1=CC2=CC(=C(C=C2C(=C1C)C3=CC(=C(C=C3)O)OC)OC)O |
| SMILES (Isomeric) | CC1=CC2=CC(=C(C=C2C(=C1C)C3=CC(=C(C=C3)O)OC)OC)O |
| InChI | InChI=1S/C20H20O4/c1-11-7-14-8-17(22)19(24-4)10-15(14)20(12(11)2)13-5-6-16(21)18(9-13)23-3/h5-10,21-22H,1-4H3 |
| InChI Key | VTKRSFMVKGHUME-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.44% | 99.15% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.48% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.62% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 91.07% | 93.31% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.94% | 92.94% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.58% | 91.79% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.05% | 89.62% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.64% | 88.48% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.83% | 98.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.64% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.04% | 95.56% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 85.74% | 95.70% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.79% | 92.62% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 83.79% | 94.67% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.63% | 93.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.10% | 98.95% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.02% | 93.03% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.81% | 91.49% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 82.63% | 89.32% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.22% | 99.17% |
| CHEMBL290 | Q13370 | Phosphodiesterase 3B | 80.32% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Etlingera philippinensis |
| Knema furfuracea |
| PubChem | 129882122 |
| LOTUS | LTS0205751 |
| wikiData | Q105292808 |