1-(3,7-Dimethylocta-2,6-dienyl)-6,8-dihydroxy-2-methoxy-3-(3-methylbut-2-enoxy)xanthen-9-one
Internal ID | a1f9a625-10da-42a1-9ea5-f59fb9bd0dfa |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > 8-prenylated xanthones |
IUPAC Name | 1-(3,7-dimethylocta-2,6-dienyl)-6,8-dihydroxy-2-methoxy-3-(3-methylbut-2-enoxy)xanthen-9-one |
SMILES (Canonical) | CC(=CCCC(=CCC1=C2C(=CC(=C1OC)OCC=C(C)C)OC3=CC(=CC(=C3C2=O)O)O)C)C |
SMILES (Isomeric) | CC(=CCCC(=CCC1=C2C(=CC(=C1OC)OCC=C(C)C)OC3=CC(=CC(=C3C2=O)O)O)C)C |
InChI | InChI=1S/C29H34O6/c1-17(2)8-7-9-19(5)10-11-21-26-24(16-25(29(21)33-6)34-13-12-18(3)4)35-23-15-20(30)14-22(31)27(23)28(26)32/h8,10,12,14-16,30-31H,7,9,11,13H2,1-6H3 |
InChI Key | ZOXSAWIMDZFTJC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H34O6 |
Molecular Weight | 478.60 g/mol |
Exact Mass | 478.23553880 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 8.00 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.85% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.75% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.81% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 91.62% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.06% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.50% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.50% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.36% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.54% | 94.75% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.35% | 96.12% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.39% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.15% | 96.09% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.12% | 92.08% |
CHEMBL2535 | P11166 | Glucose transporter | 85.14% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.93% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.97% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 83.18% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.94% | 96.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.47% | 93.10% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.66% | 96.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.44% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bahiopsis deltoidea |
Bahiopsis laciniata |
Garcinia pyrifera |
PubChem | 163067869 |
LOTUS | LTS0083850 |
wikiData | Q105352822 |