1-(3,5-Dichloro-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone
| Internal ID | 4bc7143a-a28b-4892-b0b2-d817bd0f0a05 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
| IUPAC Name | 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H16Cl2O4/c1-3-4-5-6-7(16)8-11(17)9(14)13(19-2)10(15)12(8)18/h17-18H,3-6H2,1-2H3 |
| InChI Key | VUDQSRFCCHQIIU-UHFFFAOYSA-N |
| Popularity | 152 references in papers |
| Molecular Formula | C13H16Cl2O4 |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 306.0425644 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 4.60 |
| DIF-1 |
| 1-((3,5-dichloro)-2,6-dihydroxy-4-methoxyphenyl)-1-hexanone |
| Dif-1 (dictyostelium) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one |
| Morphogen differentiation inducing factor (dictyostelium) |
| CHEBI:64598 |
| Differentiation-inducing factor 1 |
| differentiation-inducing factor-1 |
| Dictyostelium |
| C13H16Cl2O4 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.83% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.90% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.53% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.43% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.80% | 98.95% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.56% | 95.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.46% | 97.25% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.81% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.49% | 96.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.28% | 97.29% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.18% | 91.81% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.10% | 96.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.62% | 86.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.40% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 123886 |
| LOTUS | LTS0212043 |
| wikiData | Q27133348 |